| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | (1S,4R)-methyl 4-aminocyclopent-2-enecarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 |
| CAS Registry Number | 138923-03-2 |
| SMILES | COC(=O)[C@H]1C[C@H](C=C1)N |
| Solubility | 3.901e+005 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.496, Calc.* |
| Melting point | 18.06 ºC |
| Boiling Point | 207.71 ºC, 191.9±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 63.4±24.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1S,4R)-methyl 4-aminocyclopent-2-enecarboxylate |