| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15813355568 | |||
![]() |
lanningsale@sina.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 15813355568 | |||
![]() |
WhatsApp: +8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Cefaclor Dimer |
|---|---|
| Synonyms | (6R,7R)-7-{[(2R)-2-({[(6R,7R)-7-{[(2R)-2-Amino-2-phenylacetyl]amino}-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]carbonyl}amino)-2-phenylacetyl]amino}-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2 .0]oct-2-ene-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C30H26Cl2N6O7S2 |
| Molecular Weight | 717.60 |
| CAS Registry Number | 142975-51-7 |
| SMILES | N[C@H](C1C=CC=CC=1)C(=O)N[C@H]1[C@H]2SCC(Cl)=C(C(=O)N[C@H](C3C=CC=CC=3)C(=O)N[C@H]3[C@H]4SCC(Cl)=C(C(O)=O)N4C3=O)N2C1=O |
| Density | 1.7±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.769, Calc.* |
| Boiling Point | 1146.2±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 647.0±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Cefaclor Dimer |