| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 3-Methyl-6-nitrocatechol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.13 |
| CAS Registry Number | 143689-93-4 |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])O)O |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.643, Calc.* |
| Boiling Point | 364.9±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 168.1±16.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-6-nitrocatechol |