| Shanghai Zzbio Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15102117276 | |||
![]() |
3001090745@qq.com info@zzsrm.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2013 | ||||
| chemBlink standard supplier since 2021 | ||||
| Classification | Biochemical >> Common amino acids and protein drugs |
|---|---|
| Name | Creatinine-(methyl-d3) |
| Synonyms | Creatinine-d3; 2-Amino-1-(2H3)Methyl-1,5-Dihydro-4H-Imidazol-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4D3N3O |
| Molecular Weight | 116.14 |
| CAS Registry Number | 143827-20-7 |
| SMILES | [2H]C([2H])([2H])N1CC(=O)N=C1N |
| Solubility | Sparingly soluble (10 mg/mL) (PBS pH 7.2) |
|---|---|
| Density | 1.513 g/cm3, Calc. |
| Melting point | 255 ºC |
| Refractive index | 1.65, Calc. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Creatinine-(methyl-d3) |