| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 4-Bromo-2-methoxybenzene-1-sulfonyl chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H6BrClO3S |
| Molecular Weight | 285.54 |
| CAS Registry Number | 145915-29-3 |
| EC Number | 827-356-7 |
| SMILES | COC1=C(C=CC(=C1)Br)S(=O)(=O)Cl |
| Solubility | 6.791 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.569, Calc.* |
| Melting point | 116.01 ºC |
| Boiling Point | 340.32 ºC, 329.2±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 152.9±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H314 Details | ||||||||||||||||
| Precautionary Statements | P280-P305+P351+P338-P310 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2-methoxybenzene-1-sulfonyl chloride |