| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-amine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.33 |
| CAS Registry Number | 146397-30-0 |
| SMILES | CC1=NN=C2N1C3=CC=CC=C3C(=NC2N)C4=CC=CC=C4 |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.736, Calc.* |
| Boiling Point | 514.7±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 265.1±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-amine |