| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Ezetimibe Impurity 110 |
|---|---|
| Synonyms | (4S)-3-{(2R)-2-{(S)-(4-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}phenyl)[(4-fluorophenyl)amino]methyl}-4-[2-(4-fluorophenyl)-5,5-dimethyl-1,3-dioxan-2-yl]butanoyl}-4-phenyl-1,3-oxazolidin-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C44H52F2N2O6Si |
| Molecular Weight | 770.98 |
| CAS Registry Number | 1478663-95-4 |
| SMILES | C(C[C@]([C@H](NC1=CC=C(C=C1)F)C2=CC=C(C=C2)O[Si](C(C)(C)C)(C)C)(C(=O)N3[C@H](COC3=O)C4=CC=CC=C4)[H])C5(OCC(CO5)(C)C)C6=CC=C(C=C6)F |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.562, Calc.* |
| Boiling Point | 793.6±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 433.8±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Ezetimibe Impurity 110 |