| CHENGDU BQ PHARMA CO., LTD. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 19381639660 | |||
![]() |
sales@bq-pharma.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | (1S,2S)-1,2-Bis(2-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.34 |
| CAS Registry Number | 148240-65-7 |
| SMILES | COC1=CC=CC=C1[C@@H]([C@H](C2=CC=CC=C2OC)N)N |
| Solubility | 5116 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.588, Calc.* |
| Melting point | 141.80 ºC |
| Boiling Point | 388.71 ºC, 441.4±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 234.5±22.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| Market Analysis Reports |
| List of Reports Available for (1S,2S)-1,2-Bis(2-methoxyphenyl)ethane-1,2-diamine |