| Xinyi Yixin Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (516) 6909-6818 | |||
![]() |
chenlimi@yixinamino.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink standard supplier since 2024 | ||||
| Name | Tetraphenylbutatriene |
|---|---|
| Synonyms | 1,4,4-triphenylbuta-1,2,3-trienylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C28H20 |
| Molecular Weight | 356.46 |
| CAS Registry Number | 1483-68-7 |
| SMILES | C1=CC=C(C=C1)C(=C=C=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
| Solubility | 0.003902 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.626, Calc.* |
| Melting point | 185.43 ºC |
| Boiling Point | 599.8±50.0 ºC (760 mmHg), Calc.*, 484.46 ºC |
| Flash Point | 314.8±24.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tetraphenylbutatriene |