| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 2-Fluoroadenosine 5'-(dihydrogen phosphate) |
|---|---|
| Synonyms | [(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| Molecular Structure | ![]() |
| Protein Sequence | G |
| Molecular Formula | C10H13FN5O7P |
| Molecular Weight | 365.21 |
| CAS Registry Number | 1492-60-0 |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)F)N |
| Solubility | 4464 mg/L (25 ºC water) |
|---|---|
| Density | 2.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.879, Calc.* |
| Melting point | 90.27 ºC |
| Boiling Point | 480.00 ºC, 864.2±75.0 ºC (760 mmHg), Calc.* |
| Flash Point | 476.4±37.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoroadenosine 5'-(dihydrogen phosphate) |