| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 1,3-Diphenylbutane |
|---|---|
| Synonyms | 4-phenylbutan-2-ylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.31 |
| CAS Registry Number | 1520-44-1 |
| EC Number | 216-186-3 |
| SMILES | CC(CCC1=CC=CC=C1)C2=CC=CC=C2 |
| Solubility | 0.5813 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.555, Calc.* |
| Melting point | 42.31 ºC |
| Boiling Point | 305.94 ºC, 295.1±10.0 ºC (760 mmHg), Calc.* |
| Flash Point | 134.3±9.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302 Details |
| Precautionary Statements | P280-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diphenylbutane |