| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Pitavastatin Impurity 17 |
|---|---|
| Synonyms | tert-butyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H23ClO4 |
| Molecular Weight | 278.77 |
| CAS Registry Number | 154026-94-5 |
| SMILES | CC1(O[C@H](C[C@H](O1)CCl)CC(=O)OC(C)(C)C)C |
| Solubility | 10.18 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.439, Calc.* |
| Melting point | 86.15 ºC |
| Boiling Point | 318.60 ºC, 326.2±22.0 ºC (760 mmHg), Calc.* |
| Flash Point | 113.6±21.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Pitavastatin Impurity 17 |