| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 2-Oxo-1,2-dihydroquinolin-8-yl acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19 |
| CAS Registry Number | 15450-72-3 |
| SMILES | CC(=O)OC1=CC=CC2=C1NC(=O)C=C2 |
| Solubility | 1.478e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.576, Calc.* |
| Melting point | 143.73 ºC |
| Boiling Point | 378.38 ºC, 415.1±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 204.8±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H317 Details |
| Precautionary Statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-1,2-dihydroquinolin-8-yl acetate |