| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Relugolix Impurity 8 |
|---|---|
| Synonyms | 6-(4-aminophenyl)-1-(2,6-difluorobenzyl)-5-((dimethylamino)methyl)-3-(6-methoxypyridazin-3-yl)thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C27H24F2N6O3S |
| Molecular Weight | 550.58 |
| CAS Registry Number | 1589503-93-4 |
| EC Number | 839-927-8 |
| SMILES | O=C(N(C1=CC=C(OC)N=N1)C2=O)N(C3=C2C(CN(C)C)=C(C4=CC=C(N)C=C4)S3)CC(C(F)=CC=C5)=C5F |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.661, Calc.* |
| Boiling Point | 769.2±70.0 ºC (760 mmHg), Calc.* |
| Flash Point | 419.0±35.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Classification | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Relugolix Impurity 8 |