| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Fmoc-L-Thr(beta-D-GlcNAc(Ac)3)-OH |
|---|---|
| Synonyms | (2S,3R)-3-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C33H38N2O13 |
| Molecular Weight | 670.66 |
| CAS Registry Number | 160168-40-1 |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.592, Calc.* |
| Boiling Point | 857.1±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 472.1±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Fmoc-L-Thr(beta-D-GlcNAc(Ac)3)-OH |