| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinolin-2(1H)-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 |
| CAS Registry Number | 16078-37-8 |
| SMILES | C1CC2=C3C(=CC=C2)CC(=O)N3C1 |
| Solubility | 1735 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.644, Calc.* |
| Melting point | 106.27 ºC |
| Boiling Point | 325.55 ºC, 355.2±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 173.7±19.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335-H412 Details |
| Precautionary Statements | P261-P264-P270-P271-P273-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinolin-2(1H)-one |