| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15813355568 | |||
![]() |
lanningsale@sina.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 15813355568 | |||
![]() |
WhatsApp: +8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Cefixime EP Impurity A |
|---|---|
| Synonyms | Aasjuvxhjfsora-fnowfjsisa-N;2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-2-[(2R)-5-methyl-7-oxo-1,2,4,5-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N5O8S2 |
| Molecular Weight | 471.46 |
| CAS Registry Number | 1614255-90-1 |
| SMILES | CC1C2=C(C(=O)O1)N[C@H](SC2)C(C(=O)O)NC(=O)/C(=N\OCC(=O)O)/C3=CSC(=N3)N |
| Density | 1.9±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.815, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Cefixime EP Impurity A |