Online Database of Chemicals from Around the World
| Chengdu Push Bio-technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (028) 8537-0506-229 | |||
 |
3004654993@qq.com | |||
 |
QQ chat | |||
 |
WeChat: 18080489829 | |||
| Chemical manufacturer since 2005 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Hydroxyvalerenic acid |
|---|---|
| Synonyms | (E)-3-[(1R,4S,7R,7aR)-1-hydroxy-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl]-2-methylprop-2-enoic acid |
| Molecular Structure | ![CAS # 1619-16-5, Hydroxyvalerenic acid, (E)-3-[(1R,4S,7R,7aR)-1-hydroxy-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl]-2-methylprop-2-enoic acid](/structures/1619-16-5.gif) |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33 |
| CAS Registry Number | 1619-16-5 |
| SMILES | C[C@@H]1CC[C@H](C2=C(C[C@H]([C@H]12)O)C)/C=C(\C)/C(=O)O |
| Solubility | 178.8 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.548, Calc.* |
| Melting point | 142.02 ºC |
| Boiling Point | 426.0±40.0 ºC (760 mmHg), Calc.*, 387.29 ºC |
| Flash Point | 225.6±23.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Hydroxyvalerenic acid |