| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Piperazine |
|---|---|
| Name | Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.31 |
| CAS Registry Number | 163521-20-8 |
| EC Number | 801-961-6 |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCNCC3 |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
|
Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate is a significant compound in the field of organic chemistry and medicinal research, known for its distinctive structure and diverse applications. With the chemical formula C16H18N2O3, this substance features a benzofuran core substituted with an ethyl ester group and a piperazine ring, offering a range of functional properties. The discovery of ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate involves the synthesis of benzofuran derivatives, which are known for their biological activity. The synthesis typically includes the reaction of a benzofuran derivative with an ethyl ester and a piperazine group. This process yields the target compound, which integrates the structural motifs necessary for its biological and chemical applications. Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate is prominently used in medicinal chemistry due to its pharmacological properties. The compound’s structure allows it to interact with various biological targets, making it a valuable candidate for drug development. The piperazine ring is known for its ability to form strong interactions with biological receptors, which can be exploited to develop novel therapeutics. The benzofuran moiety contributes to the compound’s potential as a lead structure in the design of drugs with enhanced efficacy and selectivity. In pharmaceutical research, ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate is utilized as a scaffold for developing new drugs. Its ability to interact with different biological systems is explored to create compounds with specific therapeutic effects, such as antimicrobial, antitumor, or anti-inflammatory properties. The compound serves as a starting point for modifying and optimizing drug candidates, leading to the development of new medications with improved performance. Additionally, the compound is used in the synthesis of novel materials and chemical probes. Its structural features make it a useful building block for creating functionalized compounds with applications in various fields. For example, the compound can be incorporated into polymeric materials to enhance their properties or used as a chemical probe to study biological mechanisms. Research into ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate also includes studies on its potential side effects and toxicology. Understanding these aspects is crucial for advancing the compound from research to clinical applications. The compound’s interactions with biological systems are carefully evaluated to ensure safety and efficacy in potential therapeutic uses. Overall, ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate is a valuable compound in organic and medicinal chemistry, with applications spanning drug development, material science, and chemical research. Its unique structural features and biological activity make it an important substance for exploring new therapeutic options and advancing scientific knowledge. |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate |