| Suzhou Biosyntech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13921151340 +86 (512) 6300-1269 | |||
![]() |
sales2@biosyntech-suzhou.com sales@biosyntech-suzhou.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2019 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | Rel-methyl 4-((2S,4S)-4-ethoxypiperidin-2-yl)benzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33 |
| CAS Registry Number | 1644667-62-8 |
| SMILES | CCOC1CCNC(C1)C2=CC=C(C=C2)C(=O)OC |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.533, Calc.* |
| Boiling Point | 377.2±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 181.9±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Rel-methyl 4-((2S,4S)-4-ethoxypiperidin-2-yl)benzoate |