| Mascot I.E. CO.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (519) 8501-0339 +86 13584504415 | |||
![]() |
info@mascotchem.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2006 | ||||
| Name | 2,3-Norbornanedicarboxylic Acid |
|---|---|
| Synonyms | Bicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 1724-08-9 |
| EC Number | 663-370-8 |
| SMILES | C1CC2CC1C(C2C(=O)O)C(=O)O |
| Solubility | 2.499e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.570, Calc.* |
| Melting point | 123.66 ºC |
| Boiling Point | 346.73 ºC, 407.7±28.0 ºC (760 mmHg), Calc.* |
| Flash Point | 214.5±20.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319 Details | ||||||||||||||||||||||||||||
| Precautionary Statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2,3-Norbornanedicarboxylic Acid |