|
CAS: 17270-12-1 Product: 7-Chloro-1,3-dihydro-5-(4-hydroxyphenyl)-H-1,4-Benzodiazepin-2-one No suppilers available. |
| Name | 7-Chloro-1,3-dihydro-5-(4-hydroxyphenyl)-H-1,4-Benzodiazepin-2-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.71 |
| CAS Registry Number | 17270-12-1 |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=C(C=C3)O |
| Solubility | 504.6 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.682, Calc.* |
| Melting point | 208.02 ºC |
| Boiling Point | 490.20 ºC, 509.9±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 262.2±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-1,3-dihydro-5-(4-hydroxyphenyl)-H-1,4-Benzodiazepin-2-one |