| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Name | 3,5-Bis(trifluoromethyl)phenylacetyl chloride |
|---|---|
| Synonyms | 2-[3,5-bis(trifluoromethyl)phenyl]acetyl chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5ClF6O |
| Molecular Weight | 290.59 |
| CAS Registry Number | 174083-39-7 |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC(=O)Cl |
| Solubility | 27.78 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.426, Calc.* |
| Melting point | 36.89 ºC |
| Boiling Point | 230.36 ºC, 204.8±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 77.7±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H314 Details |
| Precautionary Statements | P260;P271;P280 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3,5-Bis(trifluoromethyl)phenylacetyl chloride |