| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 2-(Diphenylmethoxy)-N-methylethylamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 |
| CAS Registry Number | 17471-10-2 |
| SMILES | CNCCOC(C1=CC=CC=C1)C2=CC=CC=C2 |
| Solubility | 906.3 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.552, Calc.* |
| Melting point | 98.35 ºC |
| Boiling Point | 343.75 ºC, 333.8±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 142.1±13.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(Diphenylmethoxy)-N-methylethylamine |