| Alder Research Chemicals Private Limited | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (900) 301-4798 | |||
![]() |
sales@alderchemicals.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | 4,4'-(Diazoamino)dibenzenesulfonic acid |
|---|---|
| Synonyms | 4-[2-(4-Sulfophenyl)iminohydrazinyl]benzenesulfonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N3O6S2 |
| Molecular Weight | 357.36 |
| CAS Registry Number | 17596-06-4 |
| SMILES | C1=CC(=CC=C1NN=NC2=CC=C(C=C2)S(=O)(=O)O)S(=O)(=O)O |
| Solubility | 70.55 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.688, Calc.* |
| Melting point | 268.41 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4,4'-(Diazoamino)dibenzenesulfonic acid |