| NANJING TOMMLAB PHARMATECH Co., LTD | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (025) 8616-1360 | |||
![]() |
tommlab@163.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | ONO-AP 500-02 |
|---|---|
| Synonyms | 2-[[5-[2-[(E)-[phenyl(pyridin-3-yl)methylidene]amino]oxyethyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.48 |
| CAS Registry Number | 176391-41-6 |
| SMILES | C1CC2=C(C=CC=C2OCC(=O)O)C(=C1)CCO/N=C(\C3=CC=CC=C3)/C4=CN=CC=C4 |
| Solubility | 0.4274 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.611, Calc.* |
| Melting point | 247.98 ºC |
| Boiling Point | 575.75 ºC, 635.7±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 338.2±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for ONO-AP 500-02 |