| Mascot I.E. CO.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (519) 8501-0339 +86 13584504415 | |||
![]() |
info@mascotchem.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2006 | ||||
| Name | Bis(p-bromophenyl)sulfoxide |
|---|---|
| Synonyms | 1-bromo-4-(4-bromophenyl)sulfinylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Br2OS |
| Molecular Weight | 360.06 |
| CAS Registry Number | 1774-37-4 |
| SMILES | C1=CC(=CC=C1S(=O)C2=CC=C(C=C2)Br)Br |
| Solubility | 2.791 mg/L (25 ºC water) |
|---|---|
| Density | 1.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.745, Calc.* |
| Melting point | 154.91 ºC |
| Boiling Point | 406.07 ºC, 436.9±30.0 ºC (760 mmHg), Calc.* |
| Flash Point | 218.0±24.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Bis(p-bromophenyl)sulfoxide |