| Naturewill Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (28) 8263-2533 | |||
![]() |
info@naturewillbio.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2005 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Gamma-CEHC |
|---|---|
| Synonyms | 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 178167-75-4 |
| SMILES | CC1=C(C=C2CCC(OC2=C1C)(C)CCC(=O)O)O |
| Solubility | 45.26 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.549, Calc.* |
| Melting point | 169.73 ºC |
| Boiling Point | 408.24 ºC, 466.9±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 174.5±22.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Gamma-CEHC |