| LinkChem Shanghai Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 5895-0110 +86 13391192982 | |||
![]() |
sales@linkchem.cn | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2011 | ||||
| Name | 2-(Boc-amino)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid |
|---|---|
| Synonyms | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 |
| CAS Registry Number | 182291-95-8 |
| SMILES | CC(C)(C)OC(=O)NC(C1CCCC2=CC=CC=C12)C(=O)O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.543, Calc.* |
| Boiling Point | 485.5±28.0 ºC (760 mmHg), Calc.* |
| Flash Point | 247.4±24.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338-P302+P352 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(Boc-amino)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid |