Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | N-Methyl Iso Desloratadine |
|---|---|
| Synonyms | 13-chloro-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| Molecular Structure | ![CAS # 183198-48-3, N-Methyl Iso Desloratadine, 13-chloro-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene](/structures/183198-48-3.gif) |
| Molecular Formula | C20H21ClN2 |
| Molecular Weight | 324.85 |
| CAS Registry Number | 183198-48-3 |
| SMILES | CN1CCC(=CC1)C2C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl |
| Solubility | 2.713 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.617, Calc.* |
| Melting point | 176.81 ºC |
| Boiling Point | 423.80 ºC, 452.6±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 227.5±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-Methyl Iso Desloratadine |