| LinkChem Shanghai Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 5895-0110 +86 13391192982 | |||
![]() |
sales@linkchem.cn | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2011 | ||||
| Name | 5-Bromo-2-(4-bromophenyl)pyridine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H7Br2N |
| Molecular Weight | 312.99 |
| CAS Registry Number | 183619-13-8 |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=C2)Br)Br |
| Solubility | 1.992 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.632, Calc.* |
| Melting point | 121.11 ºC |
| Boiling Point | 351.57 ºC, 357.6±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 170.0±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319 Details |
| Precautionary Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-2-(4-bromophenyl)pyridine |