| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | tert-Butyl [3-(trifluoromethyl)pyrrolidin-3-yl]carbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 |
| CAS Registry Number | 186203-13-4 |
| EC Number | 803-167-5 |
| SMILES | CC(C)(C)OC(=O)NC1(CCNC1)C(F)(F)F |
| Solubility | 4665 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.443, Calc.* |
| Melting point | 70.50 ºC |
| Boiling Point | 258.19 ºC, 283.5±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 125.2±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for tert-Butyl [3-(trifluoromethyl)pyrrolidin-3-yl]carbamate |