| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 5-Bromo-4-chloro-3-indolyl beta-d-glucuronide |
|---|---|
| Synonyms | (2S,3S,4S,5R,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13BrClNO7 |
| Molecular Weight | 422.61 |
| CAS Registry Number | 18656-89-8 |
| SMILES | C1=CC(=C(C2=C1NC=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)Cl)Br |
| Solubility | 459.4 mg/L (25 ºC water) |
|---|---|
| Density | 2.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.760, Calc.* |
| Melting point | 257.79 ºC |
| Boiling Point | 596.75 ºC, 732.2±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 396.6±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-4-chloro-3-indolyl beta-d-glucuronide |