| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6532-2607 +86 18937141980 | |||
![]() |
anna.zhang@oubertec.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink massive supplier since 2020 | ||||
| Name | 1-Bromo-3-(tert-butyl)-5-iodobenzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H12BrI |
| Molecular Weight | 339.01 |
| CAS Registry Number | 186772-43-0 |
| EC Number | 968-041-5 |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)I)Br |
| Solubility | 0.0587 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.586, Calc.* |
| Melting point | 72.51 ºC |
| Boiling Point | 282.5±28.0 ºC (760 mmHg), Calc.*, 294.42 ºC |
| Flash Point | 124.7±24.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P317-P330-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-3-(tert-butyl)-5-iodobenzene |