| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Spiratisanin B |
|---|---|
| Synonyms | (13-hydroxy-5,5,9,13-tetramethyl-2-tetracyclo[10.2.2.01,10.04,9]hexadecanyl) 3-phenylprop-2-enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.63 |
| CAS Registry Number | 1902173-19-6 |
| SMILES | CC1(CCCC2(C1CC(C34C2CC(CC3)C(C4)(C)O)OC(=O)C=CC5=CC=CC=C5)C)C |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.577, Calc.* |
| Boiling Point | 544.5±33.0 ºC (760 mmHg), Calc.* |
| Flash Point | 206.4±18.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Spiratisanin B |