| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 4-Methyl-1-(3-methylpyridin-2-yl)-2-phenylpiperazine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.37 |
| CAS Registry Number | 191546-94-8 |
| EC Number | 642-329-8 |
| SMILES | CC1=C(N=CC=C1)N2CCN(CC2C3=CC=CC=C3)C |
| Solubility | 2.564e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.572, Calc.* |
| Melting point | 152.89 ºC |
| Boiling Point | 392.56 ºC, 449.9±30.0 ºC (760 mmHg), Calc.* |
| Flash Point | 225.9±24.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H411 Details | ||||||||||||||||
| Precautionary Statements | P264-P270-P273-P301+P317-P330-P391-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-1-(3-methylpyridin-2-yl)-2-phenylpiperazine |