| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 2-Methyl-2-propanyl (2R,4S)-2-cyano-4-fluoro-1-pyrrolidinecarboxylate |
|---|---|
| Synonyms | tert-Butyl (2R,4S)-2-cyano-4-fluoropyrrolidine-1-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15FN2O2 |
| Molecular Weight | 214.24 |
| CAS Registry Number | 1932001-16-5 |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C#N)F |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.472, Calc.* |
| Boiling Point | 316.7±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 145.4±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl (2R,4S)-2-cyano-4-fluoro-1-pyrrolidinecarboxylate |