| Jinan Wonder Pharmtech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 18601195352 | |||
![]() |
wonderpharmtech@gmail.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 |
| CAS Registry Number | 1948273-00-4 |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)N |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.599, Calc.* |
| Boiling Point | 344.2±30.0 ºC (760 mmHg), Calc.* |
| Flash Point | 162.0±24.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H320 Details |
| Precautionary Statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine |