| Henan Rongxinxin Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (392) 263-2999 | |||
![]() |
sales@hrongxin.xin | |||
| Chemical manufacturer since 2017 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Tetrakis(2-methylpropyl)-thiodicarbonic diamide |
|---|---|
| Synonyms | bis(2-methylpropyl)carbamothioyl N,N-bis(2-methylpropyl)carbamodithioate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H36N2S3 |
| Molecular Weight | 376.69 |
| CAS Registry Number | 204376-00-1 |
| SMILES | CC(C)CN(CC(C)C)C(=S)SC(=S)N(CC(C)C)CC(C)C |
| Density | 1.0±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.543, Calc.* |
| Boiling Point | 430.6±28.0 ºC (760 mmHg), Calc.* |
| Flash Point | 214.3±24.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Tetrakis(2-methylpropyl)-thiodicarbonic diamide |