| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | (2R,4S)-2,4-Diphenyl-5-oxooxazolidine-3-carboxylic acid benzyl ester |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.40 |
| CAS Registry Number | 205654-80-4 |
| SMILES | C1=CC=C(C=C1)COC(=O)N2[C@H](C(=O)O[C@@H]2C3=CC=CC=C3)C4=CC=CC=C4 |
| Solubility | 0.41 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.621, Calc.* |
| Melting point | 218.12 ºC |
| Boiling Point | 522.21 ºC, 591.6±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 311.6±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (2R,4S)-2,4-Diphenyl-5-oxooxazolidine-3-carboxylic acid benzyl ester |