| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Cabozantinib Impurity 15 |
|---|---|
| Synonyms | 5-(((3,4-Dimethoxyphenyl)amino)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 |
| CAS Registry Number | 213699-53-7 |
| SMILES | CC1(OC(=O)C(=CNC2=CC(=C(C=C2)OC)OC)C(=O)O1)C |
| Solubility | 0.201 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.605, Calc.* |
| Melting point | 185.94 ºC |
| Boiling Point | 475.13 ºC, 499.9±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 256.1±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Cabozantinib Impurity 15 |