| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (S)-N-((3S,6S,9R)-6-((1H-indol-3-yl)methyl)-3-benzyl-2,5,8-trioxo-1,4,7-triazacyclotridecan-9-yl)-2-amino-3-(4-hydroxyphenyl)propanamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C35H40N6O5 |
| Molecular Weight | 624.73 |
| CAS Registry Number | 213769-33-6 |
| SMILES | C1CCNC(=O)C(NC(=O)C(NC(=O)C(C1)NC(=O)C(CC2=CC=C(C=C2)O)N)CC3=CNC4=CC=CC=C43)CC5=CC=CC=C5 |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.675, Calc.* |
| Boiling Point | 1065.4±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 598.1±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (S)-N-((3S,6S,9R)-6-((1H-indol-3-yl)methyl)-3-benzyl-2,5,8-trioxo-1,4,7-triazacyclotridecan-9-yl)-2-amino-3-(4-hydroxyphenyl)propanamide |