| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Brexpiprazole Impurity 31 |
|---|---|
| Synonyms | 2,7-Bis({4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy})quinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C41H47N5O2S2 |
| Molecular Weight | 705.97 |
| CAS Registry Number | 2138169-93-2 |
| SMILES | C1CN(CCN1CCCCOC2=CC3=C(C=C2)C=CC(=N3)OCCCCN4CCN(CC4)C5=C6C=CSC6=CC=C5)C7=C8C=CSC8=CC=C7 |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.668, Calc.* |
| Boiling Point | 862.6±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 475.5±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Brexpiprazole Impurity 31 |