| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 5,7-Dichloro-4-hydroxyquinoline |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H5Cl2NO |
| Molecular Weight | 214.05 |
| CAS Registry Number | 21873-52-9 |
| EC Number | 427-420-0 |
| SMILES | C1=CNC2=C(C1=O)C(=CC(=C2)Cl)Cl |
| Solubility | 230.6 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.702, Calc.* |
| Melting point | 117.38 ºC |
| Boiling Point | 328.82 ºC, 380.6±37.0 ºC (760 mmHg), Calc.* |
| Flash Point | 184.0±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H411 Details |
| Precautionary Statements | P273-P391-P501 Details |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dichloro-4-hydroxyquinoline |