| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 6-Methyl-2,4-dioxo-N'-5'-(4-pyridylcarbonyl)-1,2,3,4-tetrahydro-5-pyrimidinesulfonohydrazid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N5O5S |
| Molecular Weight | 327.32 |
| CAS Registry Number | 220654-99-9 |
| EC Number | 606-923-0 |
| SMILES | CC1C(C(=O)NC(=O)N1)S(=O)(=O)NNC(=O)C2=CC=NC=C2 |
| Solubility | 373.4 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.669, Calc.* |
| Melting point | 295.81 ºC |
| Boiling point | 678.13 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-2,4-dioxo-N'-5'-(4-pyridylcarbonyl)-1,2,3,4-tetrahydro-5-pyrimidinesulfonohydrazid |