|
CAS: 220792-57-4 Product: Aminopurvalanol A No suppilers available. |
| Name | Aminopurvalanol A |
|---|---|
| Synonyms | (2R)-2-[[6-(3-amino-5-chloroanilino)-9-propan-2-ylpurin-2-yl]amino]-3-methylbutan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26ClN7O |
| Molecular Weight | 403.91 |
| CAS Registry Number | 220792-57-4 |
| SMILES | CC(C)[C@H](CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NC3=CC(=CC(=C3)N)Cl |
| Solubility | 8.548 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.679, Calc.* |
| Melting point | 263.62 ºC |
| Boiling Point | 609.23 ºC, 639.0±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 340.2±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319 Details |
| Precautionary Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Aminopurvalanol A |