| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Inobrodib |
|---|---|
| Synonyms | (6S)-1-(3,4-difluorophenyl)-6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxycyclohexyl)benzimidazol-2-yl]piperidin-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C30H32F2N4O3 |
| Molecular Weight | 534.60 |
| CAS Registry Number | 2222941-37-7 |
| SMILES | CC1=C(C(=NO1)C)C2=CC3=C(C=C2)N(C(=N3)[C@@H]4CCCC(=O)N4C5=CC(=C(C=C5)F)F)C6CCC(CC6)OC |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.655, Calc.* |
| Boiling Point | 761.0±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 414.0±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Inobrodib |