| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Elagolix Lactam Impurity |
|---|---|
| Synonyms | (R)-5-(2-fluoro-3-methoxyphenyl)-1-(2-fluoro-6-(trifluoromethyl)benzyl)-6-methyl-3-(2-(2-oxopyrrolidin-1-yl)-2-phenylethyl)pyrimidine-2,4(1H,3H)-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C32H28F5N3O4 |
| Molecular Weight | 613.57 |
| CAS Registry Number | 2248628-93-3 |
| SMILES | CC1=C(C(=O)N(C(=O)N1CC2=C(C=CC=C2F)C(F)(F)F)C[C@@H](C3=CC=CC=C3)N4CCCC4=O)C5=C(C(=CC=C5)OC)F |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.583, Calc.* |
| Boiling Point | 715.2±70.0 ºC (760 mmHg), Calc.* |
| Flash Point | 386.3±35.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Elagolix Lactam Impurity |