| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Roxadustat Aziridine |
|---|---|
| Synonyms | 2-(1a-methyl-6-oxo-3-phenoxy-1,1a,6,6a-tetrahydroindeno[1,2-b]azirine-6a-carboxamido)acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.34 |
| CAS Registry Number | 2301113-15-3 |
| SMILES | O=C(O)CNC(C1(C(C2=C3C=C(OC4=CC=CC=C4)C=C2)=O)C3(C)N1)=O |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.669, Calc.* |
| Boiling Point | 659.6±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 352.7±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Roxadustat Aziridine |