| Wuxi LabNetwork | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (27) 5076-6799 | |||
![]() |
vicky_zhu@labnetwork.com | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Trans-4-((benzyloxy)methyl)cyclohexanecarboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 2304449-48-5 |
| SMILES | C1CC(CCC1COCC2=CC=CC=C2)C(=O)O |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.533, Calc.* |
| Boiling Point | 390.0±15.0 ºC (760 mmHg), Calc.* |
| Flash Point | 142.3±13.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Trans-4-((benzyloxy)methyl)cyclohexanecarboxylic acid |